CAS 957372-02-0
:{[2-nitro-4-(trifluoromethyl)phenyl]sulfinyl}acetic acid
Description:
{[2-nitro-4-(trifluoromethyl)phenyl]sulfinyl}acetic acid is a chemical compound characterized by its unique functional groups and structural features. It contains a sulfinyl group, which is indicative of its potential reactivity and role in various chemical reactions. The presence of a nitro group and a trifluoromethyl group on the aromatic ring contributes to its electronic properties, making it a candidate for applications in pharmaceuticals and agrochemicals. The trifluoromethyl group is known for enhancing lipophilicity and metabolic stability, while the nitro group can participate in reduction reactions. This compound is likely to exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. Additionally, the sulfinyl moiety may impart unique reactivity patterns, making it of interest in synthetic organic chemistry. Overall, {[2-nitro-4-(trifluoromethyl)phenyl]sulfinyl}acetic acid is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.
Formula:C9H6F3NO5S
InChI:InChI=1/C9H6F3NO5S/c10-9(11,12)5-1-2-7(6(3-5)13(16)17)19(18)4-8(14)15/h1-3H,4H2,(H,14,15)
SMILES:c1cc(c(cc1C(F)(F)F)N(=O)=O)S(=O)CC(=O)O
Synonyms:- Acetic Acid, 2-[[2-Nitro-4-(Trifluoromethyl)Phenyl]Sulfinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.