CAS 957428-72-7

1-[(1-Ethyl-3-methyl-1H-pyrazol-4-yl)methyl]piperazine

Description:

1-[(1-Ethyl-3-methyl-1H-pyrazol-4-yl)methyl]piperazine is a chemical compound characterized by its unique structure, which includes a piperazine ring and a pyrazole moiety. The piperazine component contributes to its potential as a pharmacological agent, often associated with various biological activities. The presence of the ethyl and methyl groups on the pyrazole ring enhances its lipophilicity, which can influence its absorption and distribution in biological systems. This compound may exhibit properties such as being a potential ligand for receptors or enzymes, making it of interest in medicinal chemistry. Its molecular interactions can be studied through various techniques, including spectroscopy and crystallography, to understand its behavior in different environments. Additionally, the compound's stability, solubility, and reactivity can be influenced by the functional groups present, which are critical for its application in drug development or as a research tool. Overall, 1-[(1-Ethyl-3-methyl-1H-pyrazol-4-yl)methyl]piperazine represents a class of compounds that may hold promise in therapeutic applications.

Formula: C₁₁H₂₀N₄

InChI: InChI=1S/C11H20N4/c1-3-15-9-11(10(2)13-15)8-14-6-4-12-5-7-14/h9,12H,3-8H2,1-2H3

InChI key: InChIKey=VGJKCSQWIPAHSR-UHFFFAOYSA-N

SMILES: C(C=1C(C)=NN(CC)C1)N2CCNCC2

Synonyms:

• 1-[(1-Ethyl-3-methyl-1H-pyrazol-4-yl)methyl]piperazine
• Piperazine, 1-[(1-ethyl-3-methyl-1H-pyrazol-4-yl)methyl]-

1-[(1-Ethyl-3-methyl-1H-pyrazol-4-yl)methyl]piperazine

Controlled Product

CAS: 957428-72-7

Versatile small molecule scaffold

Formula: C₁₁H₂₀N₄

Purity: Min. 95%

Molecular weight: 208.3 g/mol

Ref: 3D-HNB42872