CAS 957484-31-0

5-[2-(3,5-dimethyl-1H-pyrazol-1-yl)ethyl]-1,3,4-thiadiazol-2-amine

Description:

5-[2-(3,5-dimethyl-1H-pyrazol-1-yl)ethyl]-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structural features, which include a thiadiazole ring and a pyrazole moiety. The presence of the thiadiazole ring contributes to its potential biological activity, as thiadiazoles are often associated with various pharmacological properties. The compound's molecular structure suggests it may exhibit properties such as antimicrobial, antifungal, or anti-inflammatory activities, although specific biological data would be necessary to confirm these effects. The presence of the 3,5-dimethyl-1H-pyrazole group may enhance its lipophilicity and influence its interaction with biological targets. Additionally, the compound's amine functional group can participate in hydrogen bonding, which may affect its solubility and reactivity. Overall, this compound represents a class of heterocyclic compounds that are of interest in medicinal chemistry and drug development, although further studies would be required to elucidate its full range of properties and potential applications.

Formula: C₉H₁₃N₅S

InChI: InChI=1/C9H13N5S/c1-6-5-7(2)14(13-6)4-3-8-11-12-9(10)15-8/h5H,3-4H2,1-2H3,(H2,10,12)

SMILES: Cc1cc(C)n(CCc2n[nH]c(=N)s2)n1

5-[2-(3,5-dimethyl-1H-pyrazol-1-yl)ethyl]-1,3,4-thiadiazol-2-amine

CAS: 957484-31-0

Formula: C₉H₁₃N₅S

Purity: 95.0%

Molecular weight: 223.3

Ref: 10-F310041