CAS 957487-29-5

[3-(difluoromethyl)-5-methyl-1H-pyrazol-1-yl]acetic acid

Description:

[3-(Difluoromethyl)-5-methyl-1H-pyrazol-1-yl]acetic acid is a chemical compound characterized by its unique pyrazole structure, which includes a difluoromethyl group and a methyl group attached to the pyrazole ring. This compound features an acetic acid functional group, contributing to its acidic properties. The presence of the difluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid moiety, while the pyrazole ring may provide stability and potential for various chemical reactions. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of agrochemicals or therapeutic agents. As with many pyrazole derivatives, it may also exhibit interesting pharmacological properties, including anti-inflammatory or analgesic effects, although specific biological activities would require empirical investigation. Safety and handling precautions should be observed, as with all chemical substances, particularly those with fluorinated groups.

Formula: C₇H₈F₂N₂O₂

InChI: InChI=1/C7H8F2N2O2/c1-4-2-5(7(8)9)10-11(4)3-6(12)13/h2,7H,3H2,1H3,(H,12,13)

SMILES: Cc1cc(C(F)F)nn1CC(=O)O

Synonyms:

• 1H-pyrazole-1-acetic acid, 3-(difluoromethyl)-5-methyl-

[3-(Difluoromethyl)-5-methyl-1H-pyrazol-1-yl]acetic acid

CAS: 957487-29-5

[3-(Difluoromethyl)-5-methyl-1H-pyrazol-1-yl]acetic acid

Purity: 95%

Molecular weight: 190.15g/mol

Ref: 54-PC905016