CAS 957487-32-0

5-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)-3-isoxazolecarboxylic acid

Description:

5-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)-3-isoxazolecarboxylic acid is a chemical compound characterized by its unique structural features, which include a pyrazole ring and an isoxazole moiety. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of carboxylic acid functionality, which can engage in hydrogen bonding. The pyrazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound may also display acidic properties due to the carboxylic acid group, influencing its reactivity and interactions with other molecules. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of agents targeting specific biological pathways. Additionally, the presence of ethyl and methyl substituents can affect the compound's lipophilicity and overall pharmacokinetic profile. As with many organic compounds, stability under various conditions, such as temperature and pH, is an important consideration for its practical applications.

Formula: C₁₀H₁₁N₃O₃

InChI: InChI=1S/C10H11N3O3/c1-3-13-6(2)7(5-11-13)9-4-8(10(14)15)12-16-9/h4-5H,3H2,1-2H3,(H,14,15)

InChI key: InChIKey=ICZFVKOUEQVVPE-UHFFFAOYSA-N

SMILES: CC1=C(C2=CC(C(O)=O)=NO2)C=NN1CC

Synonyms:

• 5-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)-3-isoxazolecarboxylic acid
• 3-Isoxazolecarboxylic acid, 5-(1-ethyl-5-methyl-1H-pyrazol-4-yl)-