CAS 95750-97-3

4-(3-chlorophenyl)-1H-pyrazol-5-amine

Description:

4-(3-Chlorophenyl)-1H-pyrazol-5-amine, with the CAS number 95750-97-3, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a 3-chlorophenyl group attached to the pyrazole ring, contributing to its unique properties and potential biological activity. The presence of the amino group at the 5-position of the pyrazole enhances its reactivity and solubility in various solvents. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, particularly as intermediates in drug synthesis or as active pharmaceutical ingredients due to their ability to interact with biological targets. The chlorophenyl substituent may influence the compound's lipophilicity and overall pharmacokinetic profile. Additionally, the compound's structure suggests potential for various chemical reactions, including substitution and coupling reactions, making it a versatile building block in organic synthesis. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₉H₈ClN₃

InChI: InChI=1/C9H8ClN3/c10-7-3-1-2-6(4-7)8-5-12-13-9(8)11/h1-5H,(H3,11,12,13)

Synonyms:

• 1H-pyrazol-5-amine, 4-(3-chlorophenyl)-
• 4-(3-Chloro-phenyl)-2H-pyrazol-3-yl amine
• 4-(3-chlorophenyl)-1H-pyrazol-5-amine(SALTDATA: FREE)
• 4-(3-chlorophenyl)-2H-pyrazol-3-amine
• 4-(3-Chlorophenyl)-1H-pyrazol-3-aMine
• 1H-Pyrazol-3-amine, 4-(3-chlorophenyl)-

1H-Pyrazol-3-amine, 4-(3-chlorophenyl)-

CAS: 95750-97-3

Formula: C₉H₈ClN₃

Purity: 95%

Molecular weight: 193.6329

Ref: IN-DA00IJFQ

4-(3-chlorophenyl)-1H-pyrazol-5-amine

CAS: 95750-97-3

Formula: C₉H₈ClN₃

Purity: 95.0%

Molecular weight: 193.63

Ref: 10-F311836