
CAS 957503-20-7
:1-[1-(2-Furanyl)ethyl]-3-methyl-1H-pyrazol-5-amine
Description:
1-[1-(2-Furanyl)ethyl]-3-methyl-1H-pyrazol-5-amine, with the CAS number 957503-20-7, is a chemical compound characterized by its unique structural features, which include a pyrazole ring substituted with an amine group and a furanyl moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, such as potential biological activity due to the presence of the pyrazole and furanyl groups. The pyrazole ring contributes to its reactivity and potential interactions in biological systems, while the furanyl group may enhance its lipophilicity and influence its pharmacokinetic properties. The compound's amine functionality can participate in hydrogen bonding, affecting its solubility and interaction with other molecules. Overall, this compound may be of interest in medicinal chemistry for its potential therapeutic applications, although specific biological activities and mechanisms would require further investigation through experimental studies.
Formula:C10H13N3O
InChI:InChI=1S/C10H13N3O/c1-7-6-10(11)13(12-7)8(2)9-4-3-5-14-9/h3-6,8H,11H2,1-2H3
InChI key:InChIKey=ZDWMQSHAQXXRPM-UHFFFAOYSA-N
SMILES:C(C)(N1N=C(C)C=C1N)C2=CC=CO2
Synonyms:- 1-[1-(2-Furanyl)ethyl]-3-methyl-1H-pyrazol-5-amine
- 1H-Pyrazol-5-amine, 1-[1-(2-furanyl)ethyl]-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.