CAS 957509-33-0
:7-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid
Description:
7-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrazolo-pyrimidine framework. This compound features a carboxylic acid functional group, contributing to its potential acidity and reactivity. The presence of the ethyl and methyl substituents on the pyrazole ring enhances its lipophilicity, which may influence its biological activity and solubility properties. The compound is likely to exhibit specific interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its unique structural features may also confer specific pharmacokinetic and pharmacodynamic properties. As with many heterocyclic compounds, it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. The compound's CAS number, 957509-33-0, allows for precise identification and retrieval of information in chemical databases, facilitating research and development efforts in various scientific fields.
Formula:C13H13N5O2
InChI:InChI=1S/C13H13N5O2/c1-3-17-8(2)9(7-15-17)11-4-5-14-12-6-10(13(19)20)16-18(11)12/h4-7H,3H2,1-2H3,(H,19,20)
InChI key:InChIKey=RLWZHDCIBUFLMD-UHFFFAOYSA-N
SMILES:CC1=C(C=2N3C(=CC(C(O)=O)=N3)N=CC2)C=NN1CC
Synonyms:- Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid, 7-(1-ethyl-5-methyl-1H-pyrazol-4-yl)-
- 7-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.