CAS 957510-87-1: 2-chloro-N-(1-methyl-1H-pyrazol-3-yl)acetamide

Description:2-Chloro-N-(1-methyl-1H-pyrazol-3-yl)acetamide is a chemical compound characterized by its unique structure, which includes a chloro substituent and a pyrazole moiety. This compound features a chloro group attached to the second carbon of an acetamide, while the nitrogen of the acetamide is linked to a 1-methyl-1H-pyrazole ring. The presence of the pyrazole ring contributes to its potential biological activity, as pyrazoles are known for their diverse pharmacological properties. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the acetamide functional group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Additionally, the chlorine atom may influence the compound's reactivity and interaction with biological systems. As with many chemical substances, safety data and handling precautions should be observed, as the compound may have specific toxicity or environmental considerations.

Formula:C₆H₈ClN₃O

InChI:InChI=1/C6H8ClN3O/c1-10-3-2-5(9-10)8-6(11)4-7/h2-3H,4H2,1H3,(H,8,9,11)