CAS 957510-90-6

2-chloro-N-(1,3-dimethyl-1H-pyrazol-4-yl)acetamide

Description:

2-Chloro-N-(1,3-dimethyl-1H-pyrazol-4-yl)acetamide is a chemical compound characterized by its unique structure, which includes a chloro substituent and a pyrazole moiety. This compound typically exhibits properties associated with both amides and halogenated compounds. It is likely to be a solid at room temperature, with moderate solubility in polar solvents due to the presence of the amide functional group. The chloro group can enhance its reactivity, making it useful in various synthetic applications, including medicinal chemistry. The presence of the dimethylpyrazole ring may impart specific biological activities, potentially influencing its pharmacological properties. As with many organic compounds, it is essential to handle this substance with care, considering its potential toxicity and reactivity. Safety data sheets should be consulted for proper handling and disposal guidelines. Overall, 2-chloro-N-(1,3-dimethyl-1H-pyrazol-4-yl)acetamide represents a compound of interest in research and development, particularly in the fields of pharmaceuticals and agrochemicals.

Formula: C₇H₁₀ClN₃O

InChI: InChI=1/C7H10ClN3O/c1-5-6(4-11(2)10-5)9-7(12)3-8/h4H,3H2,1-2H3,(H,9,12)

SMILES: Cc1c(cn(C)n1)N=C(CCl)O