CAS 957514-01-1
:2-Chloro-N-(1-ethyl-3-methyl-1H-pyrazol-4-yl)acetamide
Description:
2-Chloro-N-(1-ethyl-3-methyl-1H-pyrazol-4-yl)acetamide is a chemical compound characterized by its unique structure, which includes a chloro substituent and a pyrazole ring. The presence of the chloro group suggests potential reactivity, particularly in nucleophilic substitution reactions. The pyrazole moiety contributes to the compound's biological activity, often associated with various pharmacological properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the acetamide functional group, which can engage in hydrogen bonding. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of agrochemicals or pharmaceuticals. The compound's CAS number, 957514-01-1, allows for precise identification in chemical databases and literature. Safety data should be consulted for handling and storage, as compounds with halogen substituents can pose specific health and environmental risks. Overall, 2-Chloro-N-(1-ethyl-3-methyl-1H-pyrazol-4-yl)acetamide represents a compound of interest in both synthetic and applied chemistry contexts.
Formula:C8H12ClN3O
InChI:InChI=1S/C8H12ClN3O/c1-3-12-5-7(6(2)11-12)10-8(13)4-9/h5H,3-4H2,1-2H3,(H,10,13)
InChI key:InChIKey=IFCPJCYZNMTQGO-UHFFFAOYSA-N
SMILES:N(C(CCl)=O)C1=CN(CC)N=C1C
Synonyms:- 2-Chloro-N-(1-ethyl-3-methyl-1H-pyrazol-4-yl)acetamide
- Acetamide, 2-chloro-N-(1-ethyl-3-methyl-1H-pyrazol-4-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.