CymitQuimica logo

CAS 957514-22-6

:

1-(1-Cyclopropylethyl)-4-methyl-1H-pyrazol-5-amine

Description:
1-(1-Cyclopropylethyl)-4-methyl-1H-pyrazol-5-amine is a chemical compound characterized by its unique pyrazole structure, which includes a cyclopropyl group and an amine functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the amine group, which can participate in various chemical reactions, including nucleophilic substitutions. The cyclopropyl moiety may impart distinctive steric and electronic effects, influencing the compound's biological activity and interaction with other molecules. As a pyrazole derivative, it may also exhibit pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in drug development, particularly in areas targeting specific biological pathways. However, detailed studies on its toxicity, stability, and specific applications would be necessary to fully understand its characteristics and potential uses in various fields, including pharmaceuticals and agrochemicals.
Formula:C9H15N3
InChI:InChI=1S/C9H15N3/c1-6-5-11-12(9(6)10)7(2)8-3-4-8/h5,7-8H,3-4,10H2,1-2H3
InChI key:InChIKey=ZGZUIGVCZUSCRV-UHFFFAOYSA-N
SMILES:C(C)(N1C(N)=C(C)C=N1)C2CC2
Synonyms:
  • 1-(1-Cyclopropylethyl)-4-methyl-1H-pyrazol-5-amine
  • 1H-Pyrazol-5-amine, 1-(1-cyclopropylethyl)-4-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.