CAS 95755-20-7
:N-(4-{[(2,4-diaminopteridin-6-yl)methyl](methyl)amino}benzoyl)-4-fluoroglutamic acid
Description:
N-(4-{[(2,4-diaminopteridin-6-yl)methyl](methyl)amino}benzoyl)-4-fluoroglutamic acid, with the CAS number 95755-20-7, is a synthetic compound that belongs to the class of amino acids and derivatives. This substance features a complex structure that includes a pteridine moiety, which is characteristic of certain biologically active compounds, particularly in the realm of pharmaceuticals. The presence of a fluorine atom in the glutamic acid portion may influence its biochemical properties, potentially enhancing its interaction with specific biological targets. The compound is likely to exhibit properties such as solubility in polar solvents, and its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of targeted therapies. Its design indicates a focus on modulating biological pathways, possibly in the context of cancer treatment or other diseases where folate metabolism is relevant. As with many compounds of this nature, further studies would be necessary to fully elucidate its pharmacological profile and therapeutic potential.
Formula:C20H21FN8O5
InChI:InChI=1/C20H21FN8O5/c1-29(8-10-7-24-16-14(25-10)15(22)27-20(23)28-16)11-4-2-9(3-5-11)17(30)26-13(19(33)34)6-12(21)18(31)32/h2-5,7,12-13H,6,8H2,1H3,(H,26,30)(H,31,32)(H,33,34)(H4,22,23,24,27,28)
SMILES:CN(Cc1cnc2c(c(N)[nH]c(=N)n2)n1)c1ccc(cc1)C(=O)NC(CC(C(=O)O)F)C(=O)O
Synonyms:- glutamic acid, N-[4-[[(2,4-diamino-6-pteridinyl)methyl]methylamino]benzoyl]-4-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.