CAS 95758-95-5

4-[3-(trifluoromethyl)-3H-diaziren-3-yl]-D-phenylalanine

Description:

4-[3-(Trifluoromethyl)-3H-diaziren-3-yl]-D-phenylalanine, identified by its CAS number 95758-95-5, is a synthetic amino acid derivative characterized by the presence of a diazirine ring and a trifluoromethyl group. This compound features a D-phenylalanine backbone, which is an enantiomer of phenylalanine, an essential amino acid. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry and drug design. The diazirine moiety is known for its photoreactive properties, allowing it to form covalent bonds with nearby molecules upon exposure to light, which can be useful in various applications, including protein labeling and drug delivery systems. Overall, this compound's unique structural features contribute to its potential utility in biochemical research and therapeutic applications, although specific biological activities and interactions would require further investigation.

Formula: C₁₁H₁₀F₃N₃O₂

InChI: InChI=1/C11H10F3N3O2/c12-11(13,14)10(16-17-10)7-3-1-6(2-4-7)5-8(15)9(18)19/h1-4,8H,5,15H2,(H,18,19)/t8-/m1/s1

SMILES: c1cc(ccc1C[C@H](C(=O)O)N)C1(C(F)(F)F)N=N1