CymitQuimica logo

CAS 95759-51-6

:

1,1':4',1''-Terphenyl,2'-fluoro-4-pentyl-4''-propyl-

Description:
1,1':4',1''-Terphenyl,2'-fluoro-4-pentyl-4''-propyl- (CAS 95759-51-6) is an organic compound characterized by its complex structure, which includes three phenyl rings connected by carbon-carbon bonds, along with a fluorine atom and alkyl substituents. This compound exhibits properties typical of terphenyl derivatives, such as high thermal stability and good solubility in organic solvents. The presence of the fluorine atom can enhance its chemical stability and influence its electronic properties, making it potentially useful in various applications, including organic electronics and materials science. The pentyl and propyl groups contribute to its hydrophobic characteristics, affecting its solubility and interaction with other substances. Additionally, the compound may exhibit interesting photophysical properties, making it a candidate for use in light-emitting devices or as a component in liquid crystal displays. Overall, its unique structural features and substituents suggest a range of potential applications in advanced materials and chemical research.
Formula:C26H29F
InChI:InChI=1S/C26H29F/c1-3-5-6-8-21-11-15-23(16-12-21)25-18-17-24(19-26(25)27)22-13-9-20(7-4-2)10-14-22/h9-19H,3-8H2,1-2H3
InChI key:SXGOKAUBXXCAAC-UHFFFAOYSA-N
SMILES:CCCCCC1=CC=C(C=C1)C2=C(C=C(C=C2)C3=CC=C(C=C3)CCC)F
Found 5 products.