CymitQuimica logo

CAS 95769-28-1

:

(tricyclo[3.3.1.1~3,7~]dec-1-ylsulfanyl)acetic acid

Description:
Tricyclo[3.3.1.1^3,7]dec-1-ylsulfanyl)acetic acid, with the CAS number 95769-28-1, is a chemical compound characterized by its unique tricyclic structure, which consists of a decahydro-1-thia-3,7-dimethyl framework. This compound features a sulfanyl (thioether) functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the acetic acid moiety indicates that it possesses acidic properties, allowing it to participate in various chemical reactions, such as esterification or amidation. The tricyclic nature of the compound may impart specific steric and electronic properties, influencing its behavior in biological systems or as a ligand in coordination chemistry. Additionally, the compound's structural complexity may lead to interesting interactions with other molecules, making it a subject of interest in medicinal chemistry and materials science. Overall, the unique characteristics of this compound stem from its intricate molecular architecture and functional groups, which can be leveraged in various chemical applications.
Formula:C12H18O2S
InChI:InChI=1/C12H18O2S/c13-11(14)7-15-12-4-8-1-9(5-12)3-10(2-8)6-12/h8-10H,1-7H2,(H,13,14)
SMILES:C1C2CC3CC1CC(C2)(C3)SCC(=O)O
Synonyms:
  • (Adamantan-1-ylsulfanyl)acetic acid
  • Acetic Acid, 2-(Tricyclo[3.3.1.1~3,7~]Dec-1-Ylthio)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.