CAS 957793-35-0
:Ethyl cis-3-aminocyclobutanecarboxylate
Description:
Ethyl cis-3-aminocyclobutanecarboxylate is a chemical compound characterized by its unique cyclic structure and functional groups. It features a cyclobutane ring, which contributes to its rigidity and influences its reactivity. The presence of an amino group (-NH2) at the 3-position of the cyclobutane ring introduces basic properties and potential for hydrogen bonding, while the ethyl ester group (-COOEt) enhances its solubility in organic solvents. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. Its molecular structure allows for various applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The cis configuration of the amino group relative to the carboxylate moiety can affect the compound's biological activity and interaction with other molecules. As with many organic compounds, handling should be done with care, considering potential toxicity and reactivity. Overall, ethyl cis-3-aminocyclobutanecarboxylate is a versatile compound with significant implications in chemical research and application.
Formula:C7H13NO2
InChI:InChI=1/C7H13NO2/c1-2-10-7(9)5-3-6(8)4-5/h5-6H,2-4,8H2,1H3/t5-,6+
Synonyms:- Cyclobutanecarboxylic Acid, 3-Amino-, Ethyl Ester, Cis-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Cis-3-aminocyclobutanecarboxylic acid ethyl ester hydrochloride
CAS:Formula:C7H14ClNO2Purity:97%Color and Shape:SolidMolecular weight:179.6446Cis-Ethyl 3-aminocyclobutanecarboxylate hydrochloride
CAS:Cis-Ethyl 3-aminocyclobutanecarboxylate hydrochloridePurity:97%Molecular weight:179.64g/molcis-Ethyl 3-aminocyclobutanecarboxylate hydrochloride
CAS:Formula:C7H14ClNO2Purity:97%Molecular weight:179.64cis-Ethyl 3-aminocyclobutanecarboxylate hydrochloride
CAS:<p>Versatile small molecule scaffold</p>Formula:C7H14ClNO2Purity:Min. 95%Molecular weight:179.64 g/mol



