CAS 957864-31-2

1,3-Benzenediol, 5-(aminomethyl)-, hydrochloride (1:1)

Description:

1,3-Benzenediol, 5-(aminomethyl)-, hydrochloride (1:1), also known as 5-(aminomethyl)-1,3-benzenediol hydrochloride, is a chemical compound characterized by its aromatic structure featuring two hydroxyl groups (diol) and an aminomethyl substituent. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of hydroxyl groups contributes to its potential as a phenolic compound, which may exhibit antioxidant properties. The aminomethyl group can participate in various chemical reactions, making this compound of interest in medicinal chemistry and organic synthesis. Its hydrochloride form indicates that it is a salt, which can influence its pharmacokinetic properties, such as absorption and bioavailability. As with many chemical substances, safety data should be consulted to understand its handling, toxicity, and environmental impact.

Formula: C₇H₉NO₂·ClH

InChI: InChI=1S/C7H9NO2.ClH/c8-4-5-1-6(9)3-7(10)2-5;/h1-3,9-10H,4,8H2;1H

InChI key: InChIKey=YZHPSBGVKUBVMX-UHFFFAOYSA-N

SMILES: C(N)C1=CC(O)=CC(O)=C1.Cl

Synonyms:

• 3,5-Dihydroxybenzylamine hydrochloride
• 1,3-Benzenediol, 5-(aminomethyl)-, hydrochloride (1:1)

3,5-Dihydroxybenzylamine hydrochloride

CAS: 957864-31-2

Formula: C₇H₁₀ClNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 175.6128

Ref: IN-DA01E9EH

5-(Aminomethyl)benzene-1,3-diol hydrochloride

CAS: 957864-31-2

5-(Aminomethyl)benzene-1,3-diol hydrochloride

Purity: 97%

Molecular weight: 175.61g/mol

Ref: 54-OR1070071

3,5-Dihydroxybenzylamine hydrochloride

CAS: 957864-31-2

3,5-Dihydroxybenzylamine hydrochloride is a high quality chemical used as a reagent for organic synthesis. It has also been used as an intermediate for the production of other chemicals and in the synthesis of complex compounds. 3,5-Dihydroxybenzylamine hydrochloride is also a useful scaffold for drug design and development. It can be used to make fine chemicals with various applications such as research chemicals, versatile building blocks, reaction components, and speciality chemicals.

Formula: C₇H₁₀ClNO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 175.61 g/mol

Ref: 3D-FD66837