CAS 957995-85-6

1,3-Benzoxazole-4-carboxamide

Description:

1,3-Benzoxazole-4-carboxamide is a heterocyclic organic compound characterized by its benzoxazole ring structure, which consists of a fused benzene and oxazole ring. This compound features a carboxamide functional group at the 4-position of the benzoxazole, contributing to its chemical reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in polar organic solvents. The presence of the carboxamide group enhances its ability to form hydrogen bonds, which can influence its interactions in biological systems. 1,3-Benzoxazole derivatives are known for their diverse pharmacological properties, including antimicrobial, anti-inflammatory, and anticancer activities. The compound's unique structure allows it to participate in various chemical reactions, making it of interest in medicinal chemistry and material science. Its specific applications and efficacy can vary based on the substituents and the overall molecular context, highlighting the importance of structure-activity relationships in drug development.

Formula: C₈H₆N₂O₂

InChI: InChI=1S/C8H6N2O2/c9-8(11)5-2-1-3-6-7(5)10-4-12-6/h1-4H,(H2,9,11)

SMILES: c1cc(c2c(c1)ocn2)C(=N)O

Synonyms:

• 4-Benzoxazolecarboxamide

Benzo[d]oxazole-4-carboxamide

CAS: 957995-85-6

Formula: C₈H₆N₂O₂

Molecular weight: 162.1454

Ref: IN-DA00H7BN

1,3-Benzoxazole-4-carboxamide

CAS: 957995-85-6

1,3-Benzoxazole-4-carboxamide

Purity: ≥95%

Molecular weight: 162.15g/mol

Ref: 54-OR305030