CAS 958-74-7
:3-methylthymidine
Description:
3-Methylthymidine is a modified nucleoside that is structurally related to thymidine, which is one of the building blocks of DNA. It features a methyl group attached to the 3' position of the thymidine molecule, which can influence its biochemical properties and interactions. This modification can affect the stability of nucleic acids and their interactions with enzymes, potentially impacting processes such as DNA replication and repair. 3-Methylthymidine is often used in biochemical research, particularly in studies involving DNA synthesis and modification. Its CAS number, 958-74-7, is a unique identifier that allows for the precise identification of this compound in scientific literature and databases. The presence of the methyl group can also affect the compound's solubility, reactivity, and biological activity, making it a subject of interest in medicinal chemistry and molecular biology. Overall, 3-methylthymidine serves as an important tool for understanding nucleic acid chemistry and the role of modifications in genetic processes.
Formula:C11H16N2O5
InChI:InChI=1/C11H16N2O5/c1-6-4-13(11(17)12(2)10(6)16)9-3-7(15)8(5-14)18-9/h4,7-9,14-15H,3,5H2,1-2H3/t7-,8+,9+/m0/s1
Synonyms:- Methylthymidine
- Thymidine, 3-methyl-
- 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3,5-dimethyl-pyrimidine-2,4-dione
- 1-[(2R,4S,5R)-4-hydroxy-5-methylol-tetrahydrofuran-2-yl]-3,5-dimethyl-pyrimidine-2,4-quinone
- 3-METHYLTHYMIDINE
- N3-METHYLTHYMIDINE
- 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3,5-dimethylpyrimidine-2,4-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N3-Methylthymidine
CAS:N3-Methylthymidine is a Nucleoside Derivative - N-Methylated nucleoside.Formula:C11H16N2O5Color and Shape:SolidMolecular weight:256.26Ref: TM-TNU1189
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquireN3-Methylthymidine
CAS:Controlled ProductFormula:C11H16N2O5Color and Shape:NeatMolecular weight:256.26N3-Methylthymidine
CAS:N3-Methylthymidine is a metalloprotease inhibitor that has been shown to inhibit the activity of epidermal growth factor (EGF). N3-Methylthymidine is also an effective inhibitor of HIV infection. The inhibitory effect on HIV infection is due to the competitive inhibition of viral protease and subsequent degradation of viral proteins. N3-Methylthymidine inhibits the synthesis and release of infectious herpes simplex virus particles. This drug also inhibits the growth of human tumor cells in culture by inhibiting cell proliferation, most likely due to its ability to inhibit EGF. An analytical method for determining the concentration of this drug in plasma using chemical ligation has been developed.Formula:C11H16N2O5Purity:Min. 95%Color and Shape:White PowderMolecular weight:256.26 g/mol



