
CAS 958230-30-3
:4-Chloro-3-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxaldehyde
Description:
4-Chloro-3-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxaldehyde is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which incorporates both pyrrole and pyridine rings. This compound features a chloro substituent at the 4-position and a methyl group at the 3-position of the pyrrole ring, along with an aldehyde functional group at the 5-position. The presence of these functional groups contributes to its reactivity and potential applications in medicinal chemistry and organic synthesis. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its unique structure allows for potential interactions with biological targets, making it of interest in drug discovery and development. Additionally, the presence of the chloro group can enhance its electrophilic character, influencing its reactivity in various chemical reactions. As with many heterocycles, it may also exhibit interesting electronic properties, which can be leveraged in the design of new materials or pharmaceuticals.
Formula:C9H7ClN2O
InChI:InChI=1S/C9H7ClN2O/c1-5-2-11-9-7(5)8(10)6(4-13)3-12-9/h2-4H,1H3,(H,11,12)
InChI key:InChIKey=FUSILNQDOKPZAN-UHFFFAOYSA-N
SMILES:ClC1=C2C(=NC=C1C=O)NC=C2C
Synonyms:- 4-Chloro-3-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxaldehyde
- 1H-Pyrrolo[2,3-b]pyridine-5-carboxaldehyde, 4-chloro-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.