CymitQuimica logo

CAS 95826-03-2

:

(5Z,7Z)-23,23-difluoro-9,10-secocholesta-5,7,10-triene-3,25-diol

Description:
(5Z,7Z)-23,23-difluoro-9,10-secocholesta-5,7,10-triene-3,25-diol is a synthetic compound characterized by its unique structural features, including the presence of two fluorine atoms and a seco structure, which indicates a cleavage in the steroid framework. This compound belongs to the class of sterols and exhibits a triene system, suggesting it has multiple double bonds within its carbon chain. The presence of hydroxyl groups at the 3 and 25 positions contributes to its potential biological activity, possibly influencing its solubility and reactivity. The specific stereochemistry indicated by the (5Z,7Z) configuration suggests that the double bonds are in the cis orientation, which can significantly affect the compound's interactions with biological systems. As a fluorinated derivative, it may exhibit altered pharmacokinetic properties compared to its non-fluorinated counterparts, potentially enhancing its stability or bioactivity. Overall, this compound's unique characteristics make it of interest in medicinal chemistry and biochemistry research.
Formula:C27H42F2O2
InChI:InChI=1/C27H42F2O2/c1-18-8-11-22(30)15-21(18)10-9-20-7-6-14-26(5)23(12-13-24(20)26)19(2)16-27(28,29)17-25(3,4)31/h9-10,19,22-24,30-31H,1,6-8,11-17H2,2-5H3/b20-9-,21-10-
SMILES:C=C1CCC(C/C/1=C/C=C\1/CCCC2(C)C(CCC12)C(C)CC(CC(C)(C)O)(F)F)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.