CAS 958266-09-6
:4-Chloro-3-(phenylmethoxy)pyridine
Description:
4-Chloro-3-(phenylmethoxy)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 4-position and a phenylmethoxy group at the 3-position contributes to its unique chemical properties. This compound typically exhibits moderate to high lipophilicity due to the aromatic phenyl group, which can influence its solubility in organic solvents. It may also display biological activity, making it of interest in pharmaceutical research. The molecular structure allows for potential interactions with various biological targets, and its reactivity can be influenced by the electron-withdrawing nature of the chlorine substituent. Additionally, the compound may undergo typical reactions associated with pyridine derivatives, such as electrophilic substitution or nucleophilic attack, depending on the reaction conditions. Overall, 4-Chloro-3-(phenylmethoxy)pyridine is a versatile compound with potential applications in medicinal chemistry and material science.
Formula:C12H10ClNO
InChI:InChI=1/C12H10ClNO/c13-11-6-7-14-8-12(11)15-9-10-4-2-1-3-5-10/h1-8H,9H2
SMILES:c1ccc(cc1)COc1cnccc1Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
