CAS 958298-01-6

1-(Ethenylsulfonyl)-4-methylpiperazine

Description:

1-(Ethenylsulfonyl)-4-methylpiperazine is an organic compound characterized by its piperazine ring structure, which is a six-membered saturated heterocycle containing two nitrogen atoms. The presence of the ethenylsulfonyl group introduces unique reactivity and polarity to the molecule, making it potentially useful in various chemical applications, including medicinal chemistry and materials science. This compound is likely to exhibit properties typical of sulfonyl-containing compounds, such as increased solubility in polar solvents and the ability to participate in nucleophilic substitution reactions. Additionally, the methyl group on the piperazine ring may influence its steric and electronic properties, affecting its interaction with biological targets or other chemical species. As with many piperazine derivatives, it may exhibit pharmacological activities, making it of interest in drug development. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require experimental determination or literature references for precise values.

Formula: C₇H₁₄N₂O₂S

InChI: InChI=1S/C7H14N2O2S/c1-3-12(10,11)9-6-4-8(2)5-7-9/h3H,1,4-7H2,2H3

InChI key: InChIKey=NWWDDUXLUXVLIY-UHFFFAOYSA-N

SMILES: S(C=C)(=O)(=O)N1CCN(C)CC1

Synonyms:

• 1-(Ethenylsulfonyl)-4-methylpiperazine
• Piperazine, 1-(ethenylsulfonyl)-4-methyl-