CymitQuimica logo

CAS 95831-29-1

:

Thiophene, 3-phenyl-, homopolymer

Description:
Thiophene, 3-phenyl-, homopolymer, identified by CAS number 95831-29-1, is a synthetic polymer derived from the polymerization of thiophene and phenyl-substituted thiophene monomers. This polymer exhibits a conjugated structure, which contributes to its electronic properties, making it useful in applications such as organic electronics, including organic photovoltaics and field-effect transistors. The presence of the thiophene ring imparts notable stability and conductivity, while the phenyl groups enhance its solubility and processability. The material typically displays good thermal stability and can be processed into various forms, such as films or coatings. Its optical properties can be tuned by modifying the polymer's molecular weight and the ratio of thiophene to phenyl units, allowing for versatility in applications. Additionally, the polymer's mechanical properties can vary based on its molecular structure, influencing its suitability for different industrial applications. Overall, thiophene, 3-phenyl-, homopolymer represents a significant class of materials in the field of organic electronics and advanced materials science.
Formula:(C10H8S)x
InChI:InChI=1S/C10H8S/c1-2-4-9(5-3-1)10-6-7-11-8-10/h1-8H
InChI key:InChIKey=ZDQZVKVIYAPRON-UHFFFAOYSA-N
SMILES:C=1(C=CSC1)C2=CC=CC=C2
Synonyms:
  • Thiophene, 3-phenyl-, homopolymer
  • Poly(3-phenylthiophene)
  • 3-Phenylthiophene homopolymer
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.