CAS 95832-60-3
:(cyclopentyloxy)acetic acid
Description:
(cyclopentyloxy)acetic acid, with the CAS number 95832-60-3, is an organic compound characterized by the presence of both a cyclopentyloxy group and a carboxylic acid functional group. This compound typically exhibits moderate solubility in polar solvents due to the hydrophilic carboxylic acid moiety, while the cyclopentyloxy group contributes to its hydrophobic characteristics. The presence of the cyclopentyl ring can influence the compound's reactivity and biological activity, potentially affecting its interactions with biological systems. (cyclopentyloxy)acetic acid may participate in various chemical reactions, including esterification and amidation, making it a versatile intermediate in organic synthesis. Its structural features suggest potential applications in pharmaceuticals or agrochemicals, where such compounds can serve as building blocks or active ingredients. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, (cyclopentyloxy)acetic acid represents a unique chemical entity with diverse potential applications.
Formula:C7H12O3
InChI:InChI=1/C7H12O3/c8-7(9)5-10-6-3-1-2-4-6/h6H,1-5H2,(H,8,9)
SMILES:C1CCC(C1)OCC(=O)O
Synonyms:- Acetic acid, 2-(cyclopentyloxy)-
- (Cyclopentyloxy)acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(cyclopentyloxy)acetic acid
CAS:Formula:C7H12O3Purity:95%Color and Shape:LiquidMolecular weight:144.16842-(Cyclopentyloxy)acetic acid
CAS:2-(Cyclopentyloxy)acetic acidPurity:98%Molecular weight:144.17g/mol2-(Cyclopentyloxy)acetic acid
CAS:Formula:C7H12O3Purity:≥95%Color and Shape:Liquid, OilMolecular weight:144.172-(Cyclopentyloxy)acetic acid
CAS:2-(Cyclopentyloxy)acetic acid (CPA) is an organic chemical compound that exists as a cyclic ester of acetic acid. It is an electron-rich, hydrophobic molecule with a molecular weight of 142.2 g/mol. CPA has been prepared by reacting alkyloxides with magnesium and titanium in the presence of methoxyisobutyl or phenylmagnesium bromide. CPA can be obtained through the hydrolysis of 2-cyclohexen-1-one with potassium hydroxide in methanol, or from the reaction between ethylene glycol and oxadiazole in the presence of titanium tetrachloride.Formula:C7H12O3Purity:Min. 95%Molecular weight:144.17 g/mol



