CymitQuimica logo

CAS 958332-63-3

:

methyl 4-chloro-2-(trifluoromethyl)quinoline-6-carboxylate

Description:
Methyl 4-chloro-2-(trifluoromethyl)quinoline-6-carboxylate is a synthetic organic compound characterized by its quinoline structure, which features a fused bicyclic aromatic system. This compound contains a carboxylate functional group, which contributes to its reactivity and solubility in various solvents. The presence of a chloro substituent and a trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The trifluoromethyl group is known for imparting unique electronic properties, potentially affecting the compound's interaction with biological targets. Methyl 4-chloro-2-(trifluoromethyl)quinoline-6-carboxylate may exhibit various physical properties, such as melting point and boiling point, which are influenced by its molecular structure. Additionally, its stability and reactivity can be affected by environmental conditions, making it important to handle this compound with care in laboratory settings. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and uses.
Formula:C12H7ClF3NO2
InChI:InChI=1/C12H7ClF3NO2/c1-19-11(18)6-2-3-9-7(4-6)8(13)5-10(17-9)12(14,15)16/h2-5H,1H3
SMILES:COC(=O)c1ccc2c(c1)c(cc(C(F)(F)F)n2)Cl
Synonyms:
  • Methyl 4-chloro-2-(trifluoromethyl)quinoline-6-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.