CAS 95834-35-8

1-phenyl-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carbonitrile

Description:

1-Phenyl-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carbonitrile is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a phenyl group, and a pyrrole moiety. This compound features a carbonitrile functional group, contributing to its reactivity and potential applications in various fields, including medicinal chemistry and agrochemicals. The presence of the pyrrole and pyrazole rings suggests potential biological activity, as these heterocycles are often found in pharmacologically active compounds. The compound's molecular structure allows for various interactions, making it a candidate for research in drug development. Additionally, its CAS number, 95834-35-8, serves as a unique identifier for regulatory and safety information. Overall, 1-phenyl-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carbonitrile is of interest due to its potential applications and the intriguing properties derived from its heterocyclic components.

Formula: C₁₄H₁₀N₄

InChI: InChI=1/C14H10N4/c15-10-12-11-16-18(13-6-2-1-3-7-13)14(12)17-8-4-5-9-17/h1-9,11H

SMILES: c1ccc(cc1)n1c(c(C#N)cn1)n1cccc1

1-Phenyl-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carbonitrile

CAS: 95834-35-8

1-Phenyl-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carbonitrile

Purity: ≥95%

Molecular weight: 234.26g/mol

Ref: 54-OR21181