CAS 958358-00-4

5-bromo-6-methyl-1H-pyrrolo[2,3-b]pyridine

Description:

5-Bromo-6-methyl-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 5-position and a methyl group at the 6-position enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a pale yellow to brownish color in solid form and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. Its molecular structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound's stability under standard laboratory conditions and its moderate polarity make it suitable for various chemical reactions, including nucleophilic substitutions and coupling reactions. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns associated with bromine-containing substances.

Formula: C₈H₇BrN₂

InChI: InChI=1/C8H7BrN2/c1-5-7(9)4-6-2-3-10-8(6)11-5/h2-4H,1H3,(H,10,11)

SMILES: Cc1c(cc2ccnc2[nH]1)Br

Synonyms:

• 5-Brom-6-methyl-1H-pyrrolo[2,3-b]pyridin

5-Bromo-6-methyl-1H-pyrrolo[2,3-b]pyridine

CAS: 958358-00-4

Formula: C₈H₇BrN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 211.0586

Ref: IN-DA00IJGS

5-Bromo-6-methyl-1H-pyrrolo[2,3-b]pyridine

CAS: 958358-00-4

5-Bromo-6-methyl-1H-pyrrolo[2,3-b]pyridine

Purity: 95%

Molecular weight: 211.062g/mol

Ref: 54-OR75110

5-Bromo-6-methyl-1H-pyrrolo[2,3-b]pyridine

CAS: 958358-00-4

Formula: C₈H₇BrN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 211.062

Ref: 10-F210760