CymitQuimica logo

CAS 95836-49-0

:

7-Bromo-6-methoxy-8-quinolinamine

Description:
7-Bromo-6-methoxy-8-quinolinamine is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This particular compound features a bromine atom at the 7-position and a methoxy group at the 6-position, along with an amino group at the 8-position of the quinoline ring. The presence of these substituents contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The bromine atom can participate in electrophilic substitution reactions, while the methoxy group may influence the compound's electronic properties and steric hindrance. Additionally, the amino group can act as a site for further chemical modifications or interactions, making this compound of interest in medicinal chemistry and drug development. Its CAS number, 95836-49-0, allows for easy identification and reference in chemical databases. Overall, 7-Bromo-6-methoxy-8-quinolinamine is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C10H9BrN2O
InChI:InChI=1S/C10H9BrN2O/c1-14-7-5-6-3-2-4-13-10(6)9(12)8(7)11/h2-5H,12H2,1H3
InChI key:InChIKey=ZBMMOVHOTAGSFP-UHFFFAOYSA-N
SMILES:NC=1C2=C(C=C(OC)C1Br)C=CC=N2
Synonyms:
  • 7-Bromo-6-methoxy-8-quinolinamine
  • 8-Quinolinamine, 7-bromo-6-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.