CAS 95837-21-1
:1-fluoro-4-(4-(2-(4-ethylcyclohexyl)ethyl)cyclohexyl)benzene
Description:
1-Fluoro-4-(4-(2-(4-ethylcyclohexyl)ethyl)cyclohexyl)benzene, with the CAS number 95837-21-1, is an organic compound characterized by its complex structure, which includes a fluorine atom and multiple cyclohexyl groups. This compound features a benzene ring substituted with a fluorine atom at one position and a branched alkyl chain that incorporates cyclohexyl groups, contributing to its hydrophobic nature. The presence of the fluorine atom can enhance the compound's stability and influence its reactivity, making it potentially useful in various applications, including pharmaceuticals and materials science. The bulky cyclohexyl groups may impart unique steric effects, affecting the compound's physical properties such as boiling point, melting point, and solubility. Additionally, the ethyl substituent can introduce flexibility in the molecular structure, which may be relevant in biological interactions or material properties. Overall, this compound's unique characteristics stem from its specific molecular architecture, which can lead to diverse applications in chemical research and industry.
Formula:C22H33F
InChI:InChI=1/C22H33F/c1-2-17-3-5-18(6-4-17)7-8-19-9-11-20(12-10-19)21-13-15-22(23)16-14-21/h13-20H,2-12H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(trans-4-(2-(trans-4-Ethylcyclohexyl)ethyl)cyclohexyl)-4-fluorobenzene
CAS:Formula:C22H33FMolecular weight:316.4958

