CAS 95843-19-9
:5-(1-Methyl-2-phenylethenyl)isoxazole
Description:
5-(1-Methyl-2-phenylethenyl)isoxazole, with the CAS number 95843-19-9, is an organic compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a vinyl group attached to the isoxazole, specifically a 1-methyl-2-phenylethenyl substituent, which contributes to its unique chemical properties. The presence of the phenyl group enhances its aromatic characteristics, potentially influencing its reactivity and interactions with other molecules. Isoxazoles are known for their diverse biological activities, and compounds like this one may exhibit interesting pharmacological properties. The compound's molecular structure suggests it may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, due to the electron-rich nature of the isoxazole ring. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions. Overall, 5-(1-Methyl-2-phenylethenyl)isoxazole represents a class of compounds that may have applications in medicinal chemistry and materials science.
Formula:C12H11NO
InChI:InChI=1S/C12H11NO/c1-10(12-7-8-13-14-12)9-11-5-3-2-4-6-11/h2-9H,1H3
InChI key:InChIKey=VAPVNCPFOFZTLJ-UHFFFAOYSA-N
SMILES:C(=CC1=CC=CC=C1)(C)C2=CC=NO2
Synonyms:- Isoxazole, 5-(α-methylstyryl)-
- Isoxazole, 5-(1-methyl-2-phenylethenyl)-
- 5-(1-Methyl-2-phenylethenyl)isoxazole
- 5-(1-methyl-2-phenyl-vinyl)-isoxazole
- 5-(1-PHENYLPROP-1-EN-2-YL)ISOXAZOLE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
