CAS 958451-75-7
:B-[2-(Difluoromethoxy)-5-methylphenyl]boronic acid
Description:
B-[2-(Difluoromethoxy)-5-methylphenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a difluoromethoxy group, which enhances its electronic properties and may influence its reactivity and solubility. The methyl group on the phenyl ring contributes to the steric and electronic characteristics of the molecule, potentially affecting its interactions in chemical reactions. Boronic acids are typically polar and can exhibit moderate solubility in polar solvents, while their reactivity can be modulated by substituents like the difluoromethoxy group. This compound may be utilized in cross-coupling reactions, particularly in the synthesis of complex organic molecules, and could have implications in drug development due to its structural features. As with many boronic acids, it is important to handle this substance with care, considering its potential reactivity and the need for appropriate safety measures in laboratory settings.
Formula:C8H9BF2O3
InChI:InChI=1S/C8H9BF2O3/c1-5-2-3-7(14-8(10)11)6(4-5)9(12)13/h2-4,8,12-13H,1H3
InChI key:InChIKey=BTZKEKXMBGFJMH-UHFFFAOYSA-N
SMILES:O(C(F)F)C1=C(B(O)O)C=C(C)C=C1
Synonyms:- Boronic acid, B-[2-(difluoromethoxy)-5-methylphenyl]-
- B-[2-(Difluoromethoxy)-5-methylphenyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
