CymitQuimica logo

CAS 958451-77-9

:

B-[2-(Difluoromethoxy)-5-(trifluoromethyl)phenyl]boronic acid

Description:
B-[2-(Difluoromethoxy)-5-(trifluoromethyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with both a difluoromethoxy group and a trifluoromethyl group, contributing to its unique electronic properties and hydrophobic character. The difluoromethoxy group enhances the compound's reactivity and solubility in organic solvents, while the trifluoromethyl group can influence its lipophilicity and biological activity. This compound is typically used in cross-coupling reactions, such as Suzuki-Miyaura coupling, to form carbon-carbon bonds. Its boronic acid moiety also allows for potential applications in drug development and materials science. Overall, B-[2-(Difluoromethoxy)-5-(trifluoromethyl)phenyl]boronic acid is a versatile building block in synthetic organic chemistry, with significant implications in various fields.
Formula:C8H6BF5O3
InChI:InChI=1S/C8H6BF5O3/c10-7(11)17-6-2-1-4(8(12,13)14)3-5(6)9(15)16/h1-3,7,15-16H
InChI key:InChIKey=IVGKCBYQINTZRB-UHFFFAOYSA-N
SMILES:O(C(F)F)C1=C(B(O)O)C=C(C(F)(F)F)C=C1
Synonyms:
  • Boronic acid, B-[2-(difluoromethoxy)-5-(trifluoromethyl)phenyl]-
  • B-[2-(Difluoromethoxy)-5-(trifluoromethyl)phenyl]boronic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.