
CAS 958452-23-8
:1-Bromo-3-(2,2,3,3-tetrafluoropropoxy)benzene
Description:
1-Bromo-3-(2,2,3,3-tetrafluoropropoxy)benzene is an organic compound characterized by the presence of a bromine atom and a tetrafluoropropoxy group attached to a benzene ring. The molecular structure features a bromine substituent at the meta position relative to the ether linkage, which consists of a propyl chain fully substituted with fluorine atoms. This compound is likely to exhibit properties typical of halogenated aromatic compounds, such as increased lipophilicity and potential reactivity due to the presence of the bromine atom. The tetrafluoropropoxy group contributes to its unique chemical behavior, potentially enhancing its stability and altering its solubility in various solvents. Additionally, the presence of fluorine atoms can impart distinctive electronic properties, making it of interest in various applications, including materials science and pharmaceuticals. Safety and handling considerations should be taken into account due to the potential toxicity associated with halogenated compounds. Overall, 1-Bromo-3-(2,2,3,3-tetrafluoropropoxy)benzene represents a complex structure with diverse chemical characteristics.
Formula:C9H7BrF4O
InChI:InChI=1S/C9H7BrF4O/c10-6-2-1-3-7(4-6)15-5-9(13,14)8(11)12/h1-4,8H,5H2
InChI key:InChIKey=VRRJRTYDDGIWOO-UHFFFAOYSA-N
SMILES:O(CC(C(F)F)(F)F)C1=CC(Br)=CC=C1
Synonyms:- Benzene, 1-bromo-3-(2,2,3,3-tetrafluoropropoxy)-
- 1-Bromo-3-(2,2,3,3-tetrafluoropropoxy)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Bromo-3-(2,2,3,3-tetrafluoropropoxy)benzene
CAS:1-Bromo-3-(2,2,3,3-tetrafluoropropoxy)benzene
Molecular weight:287.04889g/mol

