
CAS 958454-23-4
:1-Bromo-2-(2,2,3,3-tetrafluoropropoxy)benzene
Description:
1-Bromo-2-(2,2,3,3-tetrafluoropropoxy)benzene is an organic compound characterized by the presence of a bromine atom and a tetrafluoropropoxy group attached to a benzene ring. The molecular structure features a bromine substituent at the second position of the benzene, while the tetrafluoropropoxy group is a complex substituent that introduces significant fluorine content, enhancing the compound's chemical stability and hydrophobic properties. This compound is likely to exhibit unique physical properties, such as a high boiling point and low solubility in water, due to the presence of fluorine atoms, which are known for their electronegativity and ability to influence molecular interactions. Additionally, the bromine atom may impart reactivity, making it a potential candidate for further chemical transformations. The presence of both bromine and fluorinated groups suggests potential applications in materials science, pharmaceuticals, or as intermediates in organic synthesis. Safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks.
Formula:C9H7BrF4O
InChI:InChI=1S/C9H7BrF4O/c10-6-3-1-2-4-7(6)15-5-9(13,14)8(11)12/h1-4,8H,5H2
InChI key:InChIKey=JZPCHTXIEXOIKR-UHFFFAOYSA-N
SMILES:O(CC(C(F)F)(F)F)C1=C(Br)C=CC=C1
Synonyms:- Benzene, 1-bromo-2-(2,2,3,3-tetrafluoropropoxy)-
- 1-Bromo-2-(2,2,3,3-tetrafluoropropoxy)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Bromo-2-(2,2,3,3-tetrafluoropropoxy)benzene
CAS:1-Bromo-2-(2,2,3,3-tetrafluoropropoxy)benzene
Molecular weight:287.04889g/mol

