CAS 958454-33-6

2-(2-bromo-3-fluoro-phenyl)acetic acid

Description:

2-(2-bromo-3-fluoro-phenyl)acetic acid is an organic compound characterized by its aromatic structure and the presence of both bromine and fluorine substituents on the phenyl ring. This compound features a carboxylic acid functional group, which contributes to its acidic properties. The bromine and fluorine atoms introduce significant electronegativity and steric effects, potentially influencing the compound's reactivity and interaction with biological systems. The presence of these halogens may also enhance the compound's lipophilicity, affecting its solubility in organic solvents. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the phenyl ring that can participate in various chemical reactions. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined through experimental methods, as they can vary based on environmental conditions and the presence of other substances. Overall, 2-(2-bromo-3-fluoro-phenyl)acetic acid is a compound of interest for further study in both synthetic and applied chemistry contexts.

Formula: C₈H₆BrFO₂

InChI: InChI=1/C8H6BrFO2/c9-8-5(4-7(11)12)2-1-3-6(8)10/h1-3H,4H2,(H,11,12)

SMILES: c1cc(CC(=O)O)c(c(c1)F)Br

Synonyms:

• (2-Bromo-3-fluorophenyl)acetic acid
• Benzeneacetic Acid, 2-Bromo-3-Fluoro-
• (2-Bromo-3-fluoro-phenyl)-acetic acid

(2-bromo-3-fluorophenyl)acetic acid

CAS: 958454-33-6

Formula: C₈H₆BrFO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 233.0344

Ref: IN-DA005X04

2-Bromo-3-fluorophenylacetic acid

CAS: 958454-33-6

2-Bromo-3-fluorophenylacetic acid

Purity: 98%

Molecular weight: 233.03g/mol

Ref: 54-PC1683

2-(2-Bromo-3-fluorophenyl)acetic acid

CAS: 958454-33-6

Formula: C₈H₆BrFO₂

Purity: 95%

Color and Shape: No data available.

Molecular weight: 233.036

Ref: 10-F239346