CAS 95860-08-5

2-bromo-N-[3-(2-{4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}ethyl)phenyl]acetamide

Description:

2-bromo-N-[3-(2-{4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}ethyl)phenyl]acetamide, with the CAS number 95860-08-5, is a synthetic organic compound characterized by its complex structure, which includes a bromine atom, an acetamide functional group, and a piperazine moiety. This compound features a trifluoromethyl group, which enhances its lipophilicity and may influence its biological activity. The presence of multiple aromatic rings contributes to its stability and potential interactions with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, particularly in the context of drug development, as they may exhibit activity against various biological pathways. The bromine substituent can also play a role in modulating the compound's reactivity and solubility. Overall, this compound exemplifies the intricate design often found in medicinal chemistry, where specific functional groups are strategically incorporated to achieve desired therapeutic effects.

Formula: C₂₁H₂₃BrF₃N₃O

InChI: InChI=1/C21H23BrF3N3O/c22-15-20(29)26-18-5-1-3-16(13-18)7-8-27-9-11-28(12-10-27)19-6-2-4-17(14-19)21(23,24)25/h1-6,13-14H,7-12,15H2,(H,26,29)

SMILES: c1cc(CCN2CCN(CC2)c2cccc(c2)C(F)(F)F)cc(c1)N=C(CBr)O