CAS 958646-69-0
:B-(5-Amino-2-chlorophenyl)boronic acid
Description:
B-(5-Amino-2-chlorophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has an amino and a chlorine substituent. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and methanol, and possessing a moderate melting point. The amino group contributes to its potential as a ligand in coordination chemistry, while the boronic acid functionality allows for participation in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. Additionally, the presence of the chlorine atom can influence its reactivity and biological activity. B-(5-Amino-2-chlorophenyl)boronic acid is often utilized in the development of pharmaceuticals and agrochemicals, as well as in the synthesis of complex organic molecules. Its unique structural features enable it to interact with various biological targets, highlighting its significance in research and application within the fields of chemistry and biochemistry.
Formula:C6H7BClNO2
InChI:InChI=1S/C6H7BClNO2/c8-6-2-1-4(9)3-5(6)7(10)11/h1-3,10-11H,9H2
InChI key:InChIKey=JUMYKXJHLJGVQG-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(Cl)C=CC(N)=C1
Synonyms:- Boronic acid, B-(5-amino-2-chlorophenyl)-
- B-(5-Amino-2-chlorophenyl)boronic acid
- 5-Amino-2-chlorophenylboronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
