CAS 958647-10-4
:Flutianil
Description:
Flutianil is a chemical compound classified as a fungicide, primarily used in agricultural applications to control various fungal diseases in crops. It belongs to the class of substances known as phenylureas, which are characterized by their ability to inhibit fungal growth by interfering with specific metabolic processes. Flutianil exhibits a broad spectrum of activity against a range of fungal pathogens, making it valuable in crop protection. The compound is typically applied as a foliar spray and is known for its systemic properties, allowing it to be absorbed by plants and provide extended protection. Its mode of action involves disrupting the synthesis of essential cellular components in fungi, leading to their growth inhibition. Flutianil is generally considered to have low toxicity to non-target organisms, including humans and beneficial insects, which is an important factor in its use in integrated pest management strategies. As with any chemical pesticide, proper handling and application according to regulatory guidelines are essential to minimize environmental impact and ensure safety.
Formula:C19H14F4N2OS2
InChI:InChI=1/C19H14F4N2OS2/c1-26-15-5-3-2-4-14(15)25-8-9-27-18(25)17(11-24)28-16-10-12(19(21,22)23)6-7-13(16)20/h2-7,10H,8-9H2,1H3/b18-17-
InChI key:InChIKey=KGXUEPOHGFWQKF-ZCXUNETKSA-N
SMILES:C(\SC1=CC(C(F)(F)F)=CC=C1F)(/C#N)=C\2/N(CCS2)C3=C(OC)C=CC=C3
Synonyms:- (2Z)-2-[[2-Fluoro-5-(trifluoromethyl)phenyl]thio]-2-[3-(2-methoxyphenyl)-2-thiazolidinylidene]acetonitrile
- 958647-10-4
- Acetonitrile, 2-[[2-fluoro-5-(trifluoromethyl)phenyl]thio]-2-[3-(2-methoxyphenyl)-2-thiazolidinylidene]-, (2Z)-
- Flutianil
- Ok 5203
- V 10118
- (2Z)-2-[2-fluoro-5-(trifluoromethyl)phenyl]sulfanyl-2-[3-(2-methoxyphenyl)-1,3-thiazolidin-2-ylidene]acetonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Flutianil
CAS:Flutianil is a chemical compound from the group of thiazolidines .Formula:C19H14F4N2OS2Color and Shape:SolidMolecular weight:426.45Flutianil 100 µg/mL in Acetonitrile
CAS:Formula:C19H14F4N2OS2Color and Shape:Single SolutionMolecular weight:426.45Flutianil
CAS:Controlled ProductFormula:C19H14F4N2OS2Color and Shape:Light Yellow SolidMolecular weight:426.45Flutianil
CAS:<p>Applications Flutianil is a fungicide used in the treatment and protection of crops.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Dietz, J. et al.: Mod. Crop Prot. Comp., 2, 887 (2012); Cerkauskas, R. et al.: Can. J. Plant Pathol., 33, 385 (2011);<br></p>Formula:C19H14F4N2OS2Color and Shape:NeatMolecular weight:426.45Flutianil
CAS:Flutianil is an analog of a medicinal compound that has been shown to have potent anticancer activity. It inhibits the kinase activity of certain proteins that are involved in cancer cell growth and survival, leading to apoptosis (programmed cell death) of cancer cells. Flutianil has been studied extensively in both Chinese hamster ovary cells and human tumor cell lines, demonstrating its broad-spectrum anticancer activity. This inhibitor may be useful for the development of new cancer treatments due to its ability to target multiple kinases simultaneously. Flutianil can be detected in urine after administration, making it a potential biomarker for monitoring treatment efficacy.Formula:C19H14F4N2OS2Purity:Min. 95%Molecular weight:426.5 g/mol



