CAS 958650-96-9
:5-Isobutylthiophene-2-sulfonyl chloride
Description:
5-Isobutylthiophene-2-sulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group attached to a thiophene ring, specifically at the 2-position, with an isobutyl substituent at the 5-position. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its reactivity due to the presence of the sulfonyl chloride group, which can participate in nucleophilic substitution reactions, making it useful in organic synthesis, particularly in the preparation of sulfonamides and other derivatives. The presence of the thiophene ring contributes to its aromatic properties, potentially influencing its electronic characteristics and reactivity. Additionally, this compound may exhibit moderate to high toxicity, necessitating careful handling and appropriate safety measures in laboratory settings. Its applications can extend to pharmaceuticals, agrochemicals, and materials science, where it serves as an intermediate in the synthesis of more complex molecules.
Formula:C8H11ClO2S2
InChI:InChI=1/C8H11ClO2S2/c1-6(2)5-7-3-4-8(12-7)13(9,10)11/h3-4,6H,5H2,1-2H3
SMILES:CC(C)Cc1ccc(s1)S(=O)(=O)Cl
Synonyms:- 5-(2-Methylpropyl)-2-thiophenesulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.