CAS 95884-51-8

4-(3-Chlorophenyl)-1,2,3,6-tetrahydropyridine

Description:

4-(3-Chlorophenyl)-1,2,3,6-tetrahydropyridine is an organic compound characterized by its tetrahydropyridine core, which features a chlorine-substituted phenyl group at the 4-position. This compound is part of a class of heterocyclic compounds that exhibit diverse biological activities, making them of interest in medicinal chemistry. The presence of the chlorine atom enhances the lipophilicity and may influence the compound's interaction with biological targets. Typically, tetrahydropyridines are known for their potential as intermediates in the synthesis of various pharmaceuticals and agrochemicals. The compound's molecular structure suggests it may participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic attacks, due to the electron-withdrawing nature of the chlorine substituent. Additionally, its potential pharmacological properties could include effects on the central nervous system, although specific biological activities would require further investigation. As with many organic compounds, safety and handling precautions should be observed, given the potential toxicity associated with halogenated compounds.

Formula: C₁₁H₁₂ClN

InChI: InChI=1S/C11H12ClN/c12-11-3-1-2-10(8-11)9-4-6-13-7-5-9/h1-4,8,13H,5-7H2

InChI key: InChIKey=GUMKLSMBRGGWAH-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=CC1)C=2CCNCC2

Synonyms:

• 4-(3-Chlorophenyl)-1,2,5,6-tetrahydropyridine
• Pyridine, 4-(3-chlorophenyl)-1,2,3,6-tetrahydro-
• 4-(3-Chlorophenyl)-1,2,3,6-tetrahydropyridine

4-(3-Chlorophenyl)-1,2,3,6-tetrahydropyridine

CAS: 95884-51-8

Versatile small molecule scaffold

Formula: C₁₁H₁₂ClN

Purity: Min. 95%

Molecular weight: 193.67 g/mol

Ref: 3D-VDA88451