CAS 958863-37-1
:2-(Diethoxymethyl)-5,6-difluoro-1-methyl-1H-benzimidazole
Description:
2-(Diethoxymethyl)-5,6-difluoro-1-methyl-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with two ethoxy groups and difluoro and methyl groups. The presence of the difluoro substituents enhances its potential for biological activity, as fluorine atoms can influence the compound's lipophilicity and metabolic stability. The diethoxymethyl group contributes to the compound's solubility and reactivity, making it suitable for various applications in medicinal chemistry and drug development. This compound may exhibit interesting pharmacological properties, potentially acting as an inhibitor or modulator in biological systems. Its specific interactions and efficacy would depend on the context of its use, including the target biological pathways. As with many synthetic organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in research or therapeutic contexts.
Formula:C13H16F2N2O2
InChI:InChI=1S/C13H16F2N2O2/c1-4-18-13(19-5-2)12-16-10-6-8(14)9(15)7-11(10)17(12)3/h6-7,13H,4-5H2,1-3H3
InChI key:InChIKey=IYZLZDBZPOTGDF-UHFFFAOYSA-N
SMILES:CN1C=2C(N=C1C(OCC)OCC)=CC(F)=C(F)C2
Synonyms:- 1H-Benzimidazole, 2-(diethoxymethyl)-5,6-difluoro-1-methyl-
- 2-(Diethoxymethyl)-5,6-difluoro-1-methyl-1H-benzimidazole
- 2-(Diethoxymethyl)-5,6-difluoro-1-methyl-1H-benzo[d]imidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.