
CAS 958863-62-2
:2-Fluoro-N-methyl-3-(trifluoromethyl)benzenemethanamine
Description:
2-Fluoro-N-methyl-3-(trifluoromethyl)benzenemethanamine, identified by its CAS number 958863-62-2, is a chemical compound that belongs to the class of aromatic amines. This substance features a fluorine atom and a trifluoromethyl group attached to a benzene ring, which significantly influences its chemical properties and reactivity. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can affect its biological activity, making it of interest in pharmaceutical research. The amine functional group contributes to its potential as a nucleophile in various chemical reactions. Additionally, the fluorine substituents can impart unique electronic characteristics, potentially affecting the compound's interaction with biological targets. The compound's structure suggests it may exhibit interesting properties in terms of solubility, stability, and reactivity, making it a candidate for further study in medicinal chemistry and materials science. However, specific safety and handling guidelines should be followed due to the presence of fluorinated groups, which can pose environmental and health risks.
Formula:C9H9F4N
InChI:InChI=1S/C9H9F4N/c1-14-5-6-3-2-4-7(8(6)10)9(11,12)13/h2-4,14H,5H2,1H3
InChI key:InChIKey=QAMQJZBGYWNMDX-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(F)C(CNC)=CC=C1
Synonyms:- [[2-Fluoro-3-(trifluoromethyl)phenyl]methyl](methyl)amine
- Benzenemethanamine, 2-fluoro-N-methyl-3-(trifluoromethyl)-
- 2-Fluoro-N-methyl-3-(trifluoromethyl)benzenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.