
CAS 958863-63-3
:2,6-Dimethoxy-N-methylbenzenemethanamine
Description:
2,6-Dimethoxy-N-methylbenzenemethanamine, identified by its CAS number 958863-63-3, is an organic compound characterized by its aromatic structure and the presence of methoxy groups. This compound features a benzene ring substituted at the 2 and 6 positions with methoxy (-OCH3) groups, which can influence its reactivity and solubility. The N-methyl group indicates that there is a methyl group attached to the nitrogen atom of the amine, enhancing its basicity and potentially affecting its interaction with biological systems. The presence of the methoxy groups may also contribute to the compound's lipophilicity, impacting its ability to cross biological membranes. In terms of physical properties, such compounds typically exhibit moderate to high melting and boiling points due to their molecular structure. Additionally, 2,6-Dimethoxy-N-methylbenzenemethanamine may have applications in pharmaceuticals or as a research chemical, although specific uses would depend on further studies regarding its biological activity and safety profile.
Formula:C10H15NO2
InChI:InChI=1S/C10H15NO2/c1-11-7-8-9(12-2)5-4-6-10(8)13-3/h4-6,11H,7H2,1-3H3
InChI key:InChIKey=CXDBCUUFCOEENZ-UHFFFAOYSA-N
SMILES:C(NC)C1=C(OC)C=CC=C1OC
Synonyms:- Benzenemethanamine, 2,6-dimethoxy-N-methyl-
- [(2,6-Dimethoxyphenyl)methyl](methyl)amine
- 1-(2,6-Dimethoxyphenyl)-N-methylmethanamine
- 2,6-Dimethoxy-N-methylbenzenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.