CymitQuimica logo

CAS 958863-76-8

:

4-bromo-1-methyl-benzimidazole-2-carbaldehyde

Description:
4-Bromo-1-methyl-benzimidazole-2-carbaldehyde is an organic compound characterized by its benzimidazole core, which features a bromine substituent at the 4-position and a methyl group at the 1-position. The presence of the aldehyde functional group at the 2-position contributes to its reactivity and potential applications in organic synthesis. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The bromine atom can enhance the compound's reactivity, allowing for further functionalization or coupling reactions. Additionally, the presence of the aldehyde group can facilitate condensation reactions, making it useful in the synthesis of more complex molecules. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling and storage conditions are essential. Overall, 4-bromo-1-methyl-benzimidazole-2-carbaldehyde is a versatile compound with potential applications in various fields of chemistry.
Formula:C9H7BrN2O
InChI:InChI=1/C9H7BrN2O/c1-12-7-4-2-3-6(10)9(7)11-8(12)5-13/h2-5H,1H3
SMILES:Cn1c2cccc(c2nc1C=O)Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.