CAS 95896-08-5
:atrial natriuretic peptide human:*fragment 4-28
Description:
Atrial natriuretic peptide (ANP) is a hormone primarily produced by the heart's atrial cells, playing a crucial role in regulating blood pressure and fluid balance. The specific fragment "4-28" refers to a portion of the ANP molecule, which is involved in its biological activity. This peptide fragment is known for its natriuretic effects, promoting sodium excretion by the kidneys, which in turn helps to lower blood volume and blood pressure. The CAS number 95896-08-5 identifies this specific fragment in chemical databases, facilitating research and application in pharmacology and biochemistry. ANP and its fragments are of interest in cardiovascular research due to their potential therapeutic implications in conditions such as hypertension and heart failure. The peptide is typically characterized by its structure, which includes a sequence of amino acids that contribute to its function and interaction with specific receptors in the body. Overall, ANP fragment 4-28 is significant in understanding the physiological mechanisms of cardiovascular regulation and potential clinical applications.
Formula:C112H175N39O35S3
InChI:InChI=1/C112H177N39O35S3/c1-7-56(4)88(151-98(175)65(25-17-36-127-112(122)123)139-101(178)72(43-87(164)165)144-97(174)67(32-37-189-6)140-94(171)63(23-15-34-125-110(118)119)134-84(161)45-128-82(159)44-129-92(169)69(39-58-18-10-8-11-19-58)141-106(183)79(54-188)150-104(181)77(52-155)149-103(180)75(50-153)146-90(167)62(113)22-14-33-124-109(116)117)107(184)132-46-83(160)133-57(5)89(166)137-66(30-31-80(114)157)96(173)147-74(49-152)93(170)131-47-85(162)135-68(38-55(2)3)91(168)130-48-86(163)136-78(53-187)105(182)143-71(42-81(115)158)100(177)148-76(51-154)102(179)142-70(40-59-20-12-9-13-21-59)99(176)138-64(24-16-35-126-111(120)121)95(172)145-73(108(185)186)41-60-26-28-61(156)29-27-60/h8-13,18-21,26-29,55-57,62-79,88,152-156,187-188H,7,14-17,22-25,30-54,113H2,1-6H3,(H2,114,157)(H2,115,158)(H,128,159)(H,129,169)(H,130,168)(H,131,170)(H,132,184)(H,133,160)(H,134,161)(H,135,162)(H,136,163)(H,137,166)(H,138,176)(H,139,178)(H,140,171)(H,141,183)(H,142,179)(H,143,182)(H,144,174)(H,145,172)(H,146,167)(H,147,173)(H,148,177)(H,149,180)(H,150,181)(H,151,175)(H,164,165)(H,185,186)(H4,116,117,124)(H4,118,119,125)(H4,120,121,126)(H4,122,123,127)/t56-,57-,62-,63-,64-,65-,66-,67-,68-,69-,70-,71-,72-,73-,74-,75-,76-,77-,78-,79-,88-/m0/s1
SMILES:CC[C@H](C)[C@@H](C(=NCC(=N[C@@H](C)C(=N[C@@H](CCC(=N)O)C(=N[C@@H](CO)C(=NCC(=N[C@@H](CC(C)C)C(=NCC(=N[C@@H](CS)C(=N[C@@H](CC(=N)O)C(=N[C@@H](CO)C(=N[C@@H](Cc1ccccc1)C(=N[C@@H](CCCNC(=N)N)C(=N[C@@H](Cc1ccc(cc1)O)C(=O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)N=C([C@H](CCCNC(=N)N)N=C([C@H](CC(=O)O)N=C([C@H](CCSC)N=C([C@H](CCCNC(=N)N)N=C(CN=C(CN=C([C@H](Cc1ccccc1)N=C([C@H](CS)N=C([C@H](CO)N=C([C@H](CO)N=C([C@H](CCCNC(=N)N)N)O)O)O)O)O)O)O)O)O)O)O
Synonyms:- Anaritide
- Atrial Natriuretic Factor (4-28) (human)
- H-Arg-Ser-Ser-Cys-Phe-Gly-Gly-Arg-Met-Asp-Arg-Ile-Gly-Ala-Gln-Ser-Gly-Leu-Gly-Cys-Asn-Ser-Phe-Arg-Tyr-OH (Disulfide bond)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Anaritide
CAS:Anaritide, a synthetic form of atrial natriuretic peptide (ANP) composed of 25 amino acids, enhances the glomerular filtration rate by dilating afferent arterioles and constricting efferent arterioles. It is utilized for studying its effects on patients with acute tubular necrosis, with a focus on improving dialysis-free survival rates.Formula:C112H175N39O35S3Color and Shape:SolidMolecular weight:2724.02Atrial Natriuretic Factor (4-28) (human, bovine, porcine)
CAS:Atrial natriuretic factor (ANF) is a hormone that plays an important role in the regulation of sodium excretion and blood pressure. It binds to two different receptor sites, which are located on the cell membrane. The ANF-A receptor is found in the atria of the heart and the ANF-B receptor is found in the kidneys. ANF has been shown to increase water excretion from the kidneys and decrease blood pressure by increasing sodium excretion from the kidneys and decreasing salt retention. Atrial natriuretic factor (4-28) is a disulfide form of ANF that has a high affinity for its receptors. This agent can be labeled with a radioactive atom for use as an experimental tool for determining binding sites. Atrial natriuretic factor (4-28) can also be chemically conjugated with polymers, such as polyethylene glycol, to make it more water soluble and therefore more useful as a drug candidate.Formula:C112H175N39O35S3Purity:Min. 95%Color and Shape:SolidMolecular weight:2,724.03 g/mol

