
CAS 95898-98-9
:α-2-Furanyl-2-pyridinemethanamine
Description:
α-2-Furanyl-2-pyridinemethanamine, identified by its CAS number 95898-98-9, is an organic compound that features a fused structure comprising a furan ring and a pyridine moiety. This compound is characterized by its amine functional group, which contributes to its reactivity and potential biological activity. The presence of both the furan and pyridine rings suggests that it may exhibit interesting electronic properties and could participate in various chemical reactions, such as nucleophilic substitutions or electrophilic additions. Additionally, the compound may have implications in medicinal chemistry, as derivatives of furan and pyridine are often explored for their pharmacological properties. Its solubility, stability, and interaction with other chemical species would depend on the specific conditions, such as pH and solvent. Overall, α-2-Furanyl-2-pyridinemethanamine represents a unique structure that could be of interest in both synthetic and applied chemistry contexts.
Formula:C10H10N2O
InChI:InChI=1S/C10H10N2O/c11-10(9-5-3-7-13-9)8-4-1-2-6-12-8/h1-7,10H,11H2
InChI key:InChIKey=ZHCDZWIXZJEHJQ-UHFFFAOYSA-N
SMILES:C(N)(C1=CC=CO1)C2=CC=CC=N2
Synonyms:- 2-Pyridinemethanamine, α-2-furanyl-
- 2-Furyl-2-pyridinylmethanamine
- α-2-Furanyl-2-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
