
CAS 959063-06-0
:2-(2-Oxazolyl)benzonitrile
Description:
2-(2-Oxazolyl)benzonitrile is an organic compound characterized by its unique structural features, which include a benzonitrile moiety and an oxazole ring. The presence of the oxazole ring, a five-membered heterocyclic compound containing nitrogen and oxygen, contributes to its potential biological activity and chemical reactivity. This compound typically exhibits properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. Its molecular structure allows for various interactions, making it of interest in fields such as medicinal chemistry and materials science. The nitrile group (-C≡N) is known for its ability to participate in nucleophilic reactions, while the oxazole ring can engage in hydrogen bonding and coordination with metal ions. Overall, 2-(2-Oxazolyl)benzonitrile is a versatile compound that may serve as a building block in the synthesis of more complex molecules or as a potential candidate for pharmacological applications.
Formula:C10H6N2O
InChI:InChI=1S/C10H6N2O/c11-7-8-3-1-2-4-9(8)10-12-5-6-13-10/h1-6H
InChI key:InChIKey=RUIPXRULXWYXNR-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C=CC=C1)C2=NC=CO2
Synonyms:- 2-(2-Oxazolyl)benzonitrile
- Benzonitrile, 2-(2-oxazolyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.