
CAS 95907-04-3
:6-Hydroxy-2-pyridinecarbonitrile
Description:
6-Hydroxy-2-pyridinecarbonitrile, with the CAS number 95907-04-3, is an organic compound characterized by its pyridine ring structure, which features a hydroxyl group (-OH) and a cyano group (-C≡N) attached to the carbon chain. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. The cyano group contributes to its reactivity, making it a potential precursor for various chemical syntheses. The presence of both functional groups allows for diverse applications in pharmaceuticals, agrochemicals, and material science. Additionally, the compound may exhibit biological activity, which can be explored for potential therapeutic uses. Its stability and reactivity can vary depending on environmental conditions, such as pH and temperature. As with many organic compounds, proper handling and safety measures should be observed due to potential toxicity or reactivity.
Formula:C6H4N2O
InChI:InChI=1S/C6H4N2O/c7-4-5-2-1-3-6(9)8-5/h1-3H,(H,8,9)
InChI key:InChIKey=ZGXSOXBXXNEYNE-UHFFFAOYSA-N
SMILES:C(#N)C=1N=C(O)C=CC1
Synonyms:- 2-Pyridinecarbonitrile, 6-hydroxy-
- 6-Hydroxy-2-pyridinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.